C30H38O4S — CID 67943301
5-(2-octylsulfinylpropyl)-1,3-benzodioxole;4-phenylphenol (PubChem CID 67943301) has the molecular formula C30H38O4S and a molecular weight of 494.70 g/mol. Its IUPAC name is 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;4-phenylphenol.
| Compound Name | 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;4-phenylphenol |
|---|---|
| PubChem CID | 67943301 |
| Molecular Formula | C30H38O4S |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;4-phenylphenol |
| SMILES | CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H28O3S.C12H10O/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h9-10,13,15H,3-8,11-12,14H2,1-2H3;1-9,13H |
| InChIKey | NDLFNOAEDKWVRX-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|