C28H43NO4S2 — CID 70129115
(2R)-2-amino-3-benzylsulfanylpropan-1-ol;5-(2-octylsulfinylpropyl)-1,3-benzodioxole (PubChem CID 70129115) has the molecular formula C28H43NO4S2 and a molecular weight of 521.79 g/mol. Its IUPAC name is (2R)-2-amino-3-benzylsulfanylpropan-1-ol;5-(2-octylsulfinylpropyl)-1,3-benzodioxole.
| Compound Name | (2R)-2-amino-3-benzylsulfanylpropan-1-ol;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 70129115 |
| Molecular Formula | C28H43NO4S2 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | (2R)-2-amino-3-benzylsulfanylpropan-1-ol;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
| SMILES | CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.N[C@H](CO)CSCc1ccccc1 |
| InChI | InChI=1S/C18H28O3S.C10H15NOS/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;11-10(6-12)8-13-7-9-4-2-1-3-5-9/h9-10,13,15H,3-8,11-12,14H2,1-2H3;1-5,10,12H,6-8,11H2/t;10-/m.1/s1 |
| InChIKey | BXTHVMTZYOSCQL-RLGBJRSSSA-N |
| XLogP | 5.69 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|