C20H28Cl2O5S — CID 87207427
5-(2-octylsulfinylpropyl)-1,3-benzodioxole;oxalyl dichloride (PubChem CID 87207427) has the molecular formula C20H28Cl2O5S and a molecular weight of 451.41 g/mol. Its IUPAC name is 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;oxalyl dichloride.
| Compound Name | 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;oxalyl dichloride |
|---|---|
| PubChem CID | 87207427 |
| Molecular Formula | C20H28Cl2O5S |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;oxalyl dichloride |
| SMILES | CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.O=C(Cl)C(=O)Cl |
| InChI | InChI=1S/C18H28O3S.C2Cl2O2/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;3-1(5)2(4)6/h9-10,13,15H,3-8,11-12,14H2,1-2H3; |
| InChIKey | FVSOKDFIPCEIPM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|