C23H39NO3S3 — CID 87091123
diethylcarbamodithioic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole (PubChem CID 87091123) has the molecular formula C23H39NO3S3 and a molecular weight of 473.77 g/mol. Its IUPAC name is diethylcarbamodithioic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole.
| Compound Name | diethylcarbamodithioic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 87091123 |
| Molecular Formula | C23H39NO3S3 |
| Molecular Weight | 473.77 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | diethylcarbamodithioic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
| SMILES | CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.CCN(CC)C(=S)S |
| InChI | InChI=1S/C18H28O3S.C5H11NS2/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;1-3-6(4-2)5(7)8/h9-10,13,15H,3-8,11-12,14H2,1-2H3;3-4H2,1-2H3,(H,7,8) |
| InChIKey | HKVFDNHLQMBVJU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.77 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|