C28H50O8S — CID 67281181
1-methoxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethane;5-(2-octylsulfinylpropyl)-1,3-benzodioxole (PubChem CID 67281181) has the molecular formula C28H50O8S and a molecular weight of 546.77 g/mol. Its IUPAC name is 1-methoxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethane;5-(2-octylsulfinylpropyl)-1,3-benzodioxole.
| Compound Name | 1-methoxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethane;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 67281181 |
| Molecular Formula | C28H50O8S |
| Molecular Weight | 546.77 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | 1-methoxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethane;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
| SMILES | CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.COCCOCCOCCOCCOC |
| InChI | InChI=1S/C18H28O3S.C10H22O5/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;1-11-3-5-13-7-9-15-10-8-14-6-4-12-2/h9-10,13,15H,3-8,11-12,14H2,1-2H3;3-10H2,1-2H3 |
| InChIKey | MMEGEYKOSVFUQP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.77 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|