C9H7N3O3 — CID 174791861
N-(1-hydroxy-2-oxo-1,8-naphthyridin-3-yl)formamide (PubChem CID 174791861) has the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. Its IUPAC name is N-(1-hydroxy-2-oxo-1,8-naphthyridin-3-yl)formamide.
| Compound Name | N-(1-hydroxy-2-oxo-1,8-naphthyridin-3-yl)formamide |
|---|---|
| PubChem CID | 174791861 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | N-(1-hydroxy-2-oxo-1,8-naphthyridin-3-yl)formamide |
| SMILES | O=CNc1cc2cccnc2n(O)c1=O |
| InChI | InChI=1S/C9H7N3O3/c13-5-11-7-4-6-2-1-3-10-8(6)12(15)9(7)14/h1-5,15H,(H,11,13) |
| InChIKey | YRNYPWURTFYIML-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|