C17H15N3O3 — CID 70076203
methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate (PubChem CID 70076203) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate.
| Compound Name | methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate |
|---|---|
| PubChem CID | 70076203 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate |
| SMILES | COC(=O)Cn1c(=O)c(Nc2ccccc2)cc2cccnc21 |
| InChI | InChI=1S/C17H15N3O3/c1-23-15(21)11-20-16-12(6-5-9-18-16)10-14(17(20)22)19-13-7-3-2-4-8-13/h2-10,19H,11H2,1H3 |
| InChIKey | ORXYLCLEIFOYFJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |