methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate

C17H15N3O3 — CID 70076203

IUPACmethyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate
SMILESCOC(=O)Cn1c(=O)c(Nc2ccccc2)cc2cccnc21
InChIInChI=1S/C17H15N3O3/c1-23-15(21)11-20-16-12(6-5-9-18-16)10-14(17(20)22)19-13-7-3-2-4-8-13/h2-10,19H,11H2,1H3
InChIKeyORXYLCLEIFOYFJ-UHFFFAOYSA-N
MW309.33 g/mol
LogP2.31
Rot. Bonds4

About methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate

methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate (PubChem CID 70076203) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate
PubChem CID70076203
Molecular FormulaC17H15N3O3
Molecular Weight309.33 g/mol
Exact Mass309.11
IUPAC Namemethyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate
SMILESCOC(=O)Cn1c(=O)c(Nc2ccccc2)cc2cccnc21
InChIInChI=1S/C17H15N3O3/c1-23-15(21)11-20-16-12(6-5-9-18-16)10-14(17(20)22)19-13-7-3-2-4-8-13/h2-10,19H,11H2,1H3
InChIKeyORXYLCLEIFOYFJ-UHFFFAOYSA-N
XLogP2.31
TPSA73.22 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.33
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate?
The IUPAC name of methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate (CID 70076203) is methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate.
What is the SMILES notation for methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate?
The canonical SMILES for methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate is COC(=O)Cn1c(=O)c(Nc2ccccc2)cc2cccnc21.
What is the InChIKey of methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate?
The InChIKey is ORXYLCLEIFOYFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O3/c1-23-15(21)11-20-16-12(6-5-9-18-16)10-14(17(20)22)19-13-7-3-2-4-8-13/h2-10,19H,11H2,1H3.
What are the key properties of methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate?
methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate has a molecular weight of 309.33 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-anilino-2-oxo-1,8-naphthyridin-1-yl)acetate is sourced from PubChem (CID 70076203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).