C13H11F3N2O5S2 — CID 174798125
5-[sulfo-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 174798125) has the molecular formula C13H11F3N2O5S2 and a molecular weight of 396.37 g/mol. Its IUPAC name is 5-[sulfo-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[sulfo-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 174798125 |
| Molecular Formula | C13H11F3N2O5S2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 5-[sulfo-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1N(CCc1cccc(C(F)(F)F)c1)S(=O)(=O)O |
| InChI | InChI=1S/C13H11F3N2O5S2/c14-13(15,16)9-3-1-2-8(6-9)4-5-18(25(21,22)23)11-10(12(19)20)17-7-24-11/h1-3,6-7H,4-5H2,(H,19,20)(H,21,22,23) |
| InChIKey | RMJSHSMDFKAJBB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|