2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid

C9H8O7S — CID 174800379

IUPAC2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid
SMILESC=C1C(C(=O)O)=CC(S(=O)(=O)O)=CC1C(=O)O
InChIInChI=1S/C9H8O7S/c1-4-6(8(10)11)2-5(17(14,15)16)3-7(4)9(12)13/h2-3,6H,1H2,(H,10,11)(H,12,13)(H,14,15,16)
InChIKeyPWWYKZZIIBLZLW-UHFFFAOYSA-N
MW260.22 g/mol
LogP0.04
Rot. Bonds3

About 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid

2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 174800379) has the molecular formula C9H8O7S and a molecular weight of 260.22 g/mol. Its IUPAC name is 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid
PubChem CID174800379
Molecular FormulaC9H8O7S
Molecular Weight260.22 g/mol
Exact Mass260.00
IUPAC Name2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid
SMILESC=C1C(C(=O)O)=CC(S(=O)(=O)O)=CC1C(=O)O
InChIInChI=1S/C9H8O7S/c1-4-6(8(10)11)2-5(17(14,15)16)3-7(4)9(12)13/h2-3,6H,1H2,(H,10,11)(H,12,13)(H,14,15,16)
InChIKeyPWWYKZZIIBLZLW-UHFFFAOYSA-N
XLogP0.04
TPSA128.97 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.22
LogP ≤ 50.04
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid?
The IUPAC name of 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid (CID 174800379) is 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid.
What is the SMILES notation for 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid?
The canonical SMILES for 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid is C=C1C(C(=O)O)=CC(S(=O)(=O)O)=CC1C(=O)O.
What is the InChIKey of 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid?
The InChIKey is PWWYKZZIIBLZLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O7S/c1-4-6(8(10)11)2-5(17(14,15)16)3-7(4)9(12)13/h2-3,6H,1H2,(H,10,11)(H,12,13)(H,14,15,16).
What are the key properties of 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid?
2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid has a molecular weight of 260.22 g/mol, XLogP of 0.04, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid is sourced from PubChem (CID 174800379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).