C9H8O7S — CID 174800379
2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 174800379) has the molecular formula C9H8O7S and a molecular weight of 260.22 g/mol. Its IUPAC name is 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174800379 |
| Molecular Formula | C9H8O7S |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 2-methylidene-5-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | C=C1C(C(=O)O)=CC(S(=O)(=O)O)=CC1C(=O)O |
| InChI | InChI=1S/C9H8O7S/c1-4-6(8(10)11)2-5(17(14,15)16)3-7(4)9(12)13/h2-3,6H,1H2,(H,10,11)(H,12,13)(H,14,15,16) |
| InChIKey | PWWYKZZIIBLZLW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|