C37H34N2O4S — CID 174800568
2-(benzhydrylamino)-2-[1-benzyl-2-oxo-3-(thiophen-2-ylmethoxy)indol-3-yl]butanoic acid (PubChem CID 174800568) has the molecular formula C37H34N2O4S and a molecular weight of 602.76 g/mol. Its IUPAC name is 2-(benzhydrylamino)-2-[1-benzyl-2-oxo-3-(thiophen-2-ylmethoxy)indol-3-yl]butanoic acid.
| Compound Name | 2-(benzhydrylamino)-2-[1-benzyl-2-oxo-3-(thiophen-2-ylmethoxy)indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 174800568 |
| Molecular Formula | C37H34N2O4S |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 2-(benzhydrylamino)-2-[1-benzyl-2-oxo-3-(thiophen-2-ylmethoxy)indol-3-yl]butanoic acid |
| SMILES | CCC(NC(c1ccccc1)c1ccccc1)(C(=O)O)C1(OCc2cccs2)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C37H34N2O4S/c1-2-36(35(41)42,38-33(28-17-8-4-9-18-28)29-19-10-5-11-20-29)37(43-26-30-21-14-24-44-30)31-22-12-13-23-32(31)39(34(37)40)25-27-15-6-3-7-16-27/h3-24,33,38H,2,25-26H2,1H3,(H,41,42) |
| InChIKey | BHXSGLMQLZXXTE-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |