C14H22O6 — CID 174811941
2-[2-(1-hydroxyethyl)but-3-enoyloxy]acetic acid;3-prop-2-enoxyprop-1-ene (PubChem CID 174811941) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 2-[2-(1-hydroxyethyl)but-3-enoyloxy]acetic acid;3-prop-2-enoxyprop-1-ene.
| Compound Name | 2-[2-(1-hydroxyethyl)but-3-enoyloxy]acetic acid;3-prop-2-enoxyprop-1-ene |
|---|---|
| PubChem CID | 174811941 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-[2-(1-hydroxyethyl)but-3-enoyloxy]acetic acid;3-prop-2-enoxyprop-1-ene |
| SMILES | C=CC(C(=O)OCC(=O)O)C(C)O.C=CCOCC=C |
| InChI | InChI=1S/C8H12O5.C6H10O/c1-3-6(5(2)9)8(12)13-4-7(10)11;1-3-5-7-6-4-2/h3,5-6,9H,1,4H2,2H3,(H,10,11);3-4H,1-2,5-6H2 |
| InChIKey | XTGNKECJGRTMPZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|