About benzene;2H-triazole
benzene;2H-triazole (PubChem CID 174814163) has the molecular formula C14H15N3
and a molecular weight of 225.30 g/mol. Its IUPAC name is benzene;2H-triazole.
Molecular Properties
| Compound Name | benzene;2H-triazole |
| PubChem CID | 174814163 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | benzene;2H-triazole |
| SMILES | c1ccccc1.c1ccccc1.c1cn[nH]n1 |
| InChI | InChI=1S/2C6H6.C2H3N3/c2*1-2-4-6-5-3-1;1-2-4-5-3-1/h2*1-6H;1-2H,(H,3,4,5) |
| InChIKey | DNVFTHTXXJOVBS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2H-triazole?
The IUPAC name of benzene;2H-triazole (CID 174814163) is benzene;2H-triazole.
What is the SMILES notation for benzene;2H-triazole?
The canonical SMILES for benzene;2H-triazole is c1ccccc1.c1ccccc1.c1cn[nH]n1.
What is the InChIKey of benzene;2H-triazole?
The InChIKey is DNVFTHTXXJOVBS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6.C2H3N3/c2*1-2-4-6-5-3-1;1-2-4-5-3-1/h2*1-6H;1-2H,(H,3,4,5).
What are the key properties of benzene;2H-triazole?
benzene;2H-triazole has a molecular weight of 225.30 g/mol, XLogP of 3.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2H-triazole is sourced from PubChem (CID 174814163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).