C24H40N3O4P — CID 174817207
N'-(2-aminoethyl)ethane-1,2-diamine;diphenyl(propyl)phosphane;(3S,4R)-3,4,5-trihydroxypentanal (PubChem CID 174817207) has the molecular formula C24H40N3O4P and a molecular weight of 465.58 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;diphenyl(propyl)phosphane;(3S,4R)-3,4,5-trihydroxypentanal.
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;diphenyl(propyl)phosphane;(3S,4R)-3,4,5-trihydroxypentanal |
|---|---|
| PubChem CID | 174817207 |
| Molecular Formula | C24H40N3O4P |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;diphenyl(propyl)phosphane;(3S,4R)-3,4,5-trihydroxypentanal |
| SMILES | CCCP(c1ccccc1)c1ccccc1.NCCNCCN.O=CC[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H17P.C5H10O4.C4H13N3/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15;6-2-1-4(8)5(9)3-7;5-1-3-7-4-2-6/h3-12H,2,13H2,1H3;2,4-5,7-9H,1,3H2;7H,1-6H2/t;4-,5+;/m.0./s1 |
| InChIKey | NUERYBYVMSGFTL-GKAHHYJLSA-N |
| XLogP | 0.31 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|