C24H37Cl2NP2RuS+2 — CID 157329011
2,2-dichloroethyl(diethyl)phosphane;2-diphenylphosphanyl-N-(2-ethylsulfanylethyl)ethanamine;ruthenium(2+) (PubChem CID 157329011) has the molecular formula C24H37Cl2NP2RuS+2 and a molecular weight of 605.56 g/mol. Its IUPAC name is 2,2-dichloroethyl(diethyl)phosphane;2-diphenylphosphanyl-N-(2-ethylsulfanylethyl)ethanamine;ruthenium(2+).
| Compound Name | 2,2-dichloroethyl(diethyl)phosphane;2-diphenylphosphanyl-N-(2-ethylsulfanylethyl)ethanamine;ruthenium(2+) |
|---|---|
| PubChem CID | 157329011 |
| Molecular Formula | C24H37Cl2NP2RuS+2 |
| Molecular Weight | 605.56 g/mol |
| Exact Mass | 605.05 |
| IUPAC Name | 2,2-dichloroethyl(diethyl)phosphane;2-diphenylphosphanyl-N-(2-ethylsulfanylethyl)ethanamine;ruthenium(2+) |
| SMILES | CCP(CC)CC(Cl)Cl.CCSCCNCCP(c1ccccc1)c1ccccc1.[Ru+2] |
| InChI | InChI=1S/C18H24NPS.C6H13Cl2P.Ru/c1-2-21-16-14-19-13-15-20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-3-9(4-2)5-6(7)8;/h3-12,19H,2,13-16H2,1H3;6H,3-5H2,1-2H3;/q;;+2 |
| InChIKey | BFBISCHZSNFWJE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.56 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|