C39H34Cl2F9NP2RuS+2 — CID 158444274
[2,3-dichloro-4-(trifluoromethyl)phenyl]-bis[4-(trifluoromethyl)phenyl]phosphane;2-diphenylphosphanyl-N-(2-ethylsulfanylethyl)ethanamine;ruthenium(2+) (PubChem CID 158444274) has the molecular formula C39H34Cl2F9NP2RuS+2 and a molecular weight of 953.68 g/mol. Its IUPAC name is [2,3-dichloro-4-(trifluoromethyl)phenyl]-bis[4-(trifluoromethyl)phenyl]phosphane;2-diphenylphosphanyl-N-(2-ethylsulfanylethyl)ethanamine;ruthenium(2+).
| Compound Name | [2,3-dichloro-4-(trifluoromethyl)phenyl]-bis[4-(trifluoromethyl)phenyl]phosphane;2-diphenylphosphanyl-N-(2-ethylsulfanylethyl)ethanamine;ruthenium(2+) |
|---|---|
| PubChem CID | 158444274 |
| Molecular Formula | C39H34Cl2F9NP2RuS+2 |
| Molecular Weight | 953.68 g/mol |
| Exact Mass | 953.02 |
| IUPAC Name | [2,3-dichloro-4-(trifluoromethyl)phenyl]-bis[4-(trifluoromethyl)phenyl]phosphane;2-diphenylphosphanyl-N-(2-ethylsulfanylethyl)ethanamine;ruthenium(2+) |
| SMILES | CCSCCNCCP(c1ccccc1)c1ccccc1.FC(F)(F)c1ccc(P(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)c(Cl)c2Cl)cc1.[Ru+2] |
| InChI | InChI=1S/C21H10Cl2F9P.C18H24NPS.Ru/c22-17-15(21(30,31)32)9-10-16(18(17)23)33(13-5-1-11(2-6-13)19(24,25)26)14-7-3-12(4-8-14)20(27,28)29;1-2-21-16-14-19-13-15-20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h1-10H;3-12,19H,2,13-16H2,1H3;/q;;+2 |
| InChIKey | HDERWQCRKXTALH-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.68 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|