C16H35N3O5 — CID 174820821
6-amino-2-(dimethylamino)-2-methylhexanoic acid;4-hydroxy-2-(propylamino)butanoic acid (PubChem CID 174820821) has the molecular formula C16H35N3O5 and a molecular weight of 349.47 g/mol. Its IUPAC name is 6-amino-2-(dimethylamino)-2-methylhexanoic acid;4-hydroxy-2-(propylamino)butanoic acid.
| Compound Name | 6-amino-2-(dimethylamino)-2-methylhexanoic acid;4-hydroxy-2-(propylamino)butanoic acid |
|---|---|
| PubChem CID | 174820821 |
| Molecular Formula | C16H35N3O5 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | 6-amino-2-(dimethylamino)-2-methylhexanoic acid;4-hydroxy-2-(propylamino)butanoic acid |
| SMILES | CCCNC(CCO)C(=O)O.CN(C)C(C)(CCCCN)C(=O)O |
| InChI | InChI=1S/C9H20N2O2.C7H15NO3/c1-9(8(12)13,11(2)3)6-4-5-7-10;1-2-4-8-6(3-5-9)7(10)11/h4-7,10H2,1-3H3,(H,12,13);6,8-9H,2-5H2,1H3,(H,10,11) |
| InChIKey | DXGHDKLURUQVCJ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|