About tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate
tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate (PubChem CID 174821084) has the molecular formula C10H17N2O3+
and a molecular weight of 213.26 g/mol. Its IUPAC name is tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate |
| PubChem CID | 174821084 |
| Molecular Formula | C10H17N2O3+ |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate |
| SMILES | CC1=[N+](C(=O)OC(C)(C)C)CC(=O)N1C |
| InChI | InChI=1S/C10H17N2O3/c1-7-11(5)8(13)6-12(7)9(14)15-10(2,3)4/h6H2,1-5H3/q+1 |
| InChIKey | YMFCPANZQPRMJP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate?
The IUPAC name of tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate (CID 174821084) is tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate.
What is the SMILES notation for tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate?
The canonical SMILES for tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate is CC1=[N+](C(=O)OC(C)(C)C)CC(=O)N1C.
What is the InChIKey of tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate?
The InChIKey is YMFCPANZQPRMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N2O3/c1-7-11(5)8(13)6-12(7)9(14)15-10(2,3)4/h6H2,1-5H3/q+1.
What are the key properties of tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate?
tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate has a molecular weight of 213.26 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1,2-dimethyl-5-oxo-4H-imidazol-3-ium-3-carboxylate is sourced from PubChem (CID 174821084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).