C10H9FO2 — CID 174821634
6-fluoro-3-(hydroxymethyl)-2,3-dihydroinden-1-one (PubChem CID 174821634) has the molecular formula C10H9FO2 and a molecular weight of 180.18 g/mol. Its IUPAC name is 6-fluoro-3-(hydroxymethyl)-2,3-dihydroinden-1-one.
| Compound Name | 6-fluoro-3-(hydroxymethyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 174821634 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 6-fluoro-3-(hydroxymethyl)-2,3-dihydroinden-1-one |
| SMILES | O=C1CC(CO)c2ccc(F)cc21 |
| InChI | InChI=1S/C10H9FO2/c11-7-1-2-8-6(5-12)3-10(13)9(8)4-7/h1-2,4,6,12H,3,5H2 |
| InChIKey | KPEBHWCKHVOLKP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |