C13H28ClN — CID 174821902
chloromethane;5,5,7,7-tetramethyloct-2-en-1-amine (PubChem CID 174821902) has the molecular formula C13H28ClN and a molecular weight of 233.83 g/mol. Its IUPAC name is chloromethane;5,5,7,7-tetramethyloct-2-en-1-amine.
| Compound Name | chloromethane;5,5,7,7-tetramethyloct-2-en-1-amine |
|---|---|
| PubChem CID | 174821902 |
| Molecular Formula | C13H28ClN |
| Molecular Weight | 233.83 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | chloromethane;5,5,7,7-tetramethyloct-2-en-1-amine |
| SMILES | CC(C)(C)CC(C)(C)CC=CCN.CCl |
| InChI | InChI=1S/C12H25N.CH3Cl/c1-11(2,3)10-12(4,5)8-6-7-9-13;1-2/h6-7H,8-10,13H2,1-5H3;1H3 |
| InChIKey | DOKSZFHWUPPANI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|