C23H30N2O4 — CID 174826855
1-methylpiperazine;2,3,6,7-tetramethoxyphenanthrene (PubChem CID 174826855) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-methylpiperazine;2,3,6,7-tetramethoxyphenanthrene.
| Compound Name | 1-methylpiperazine;2,3,6,7-tetramethoxyphenanthrene |
|---|---|
| PubChem CID | 174826855 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-methylpiperazine;2,3,6,7-tetramethoxyphenanthrene |
| SMILES | CN1CCNCC1.COc1cc2ccc3cc(OC)c(OC)cc3c2cc1OC |
| InChI | InChI=1S/C18H18O4.C5H12N2/c1-19-15-7-11-5-6-12-8-16(20-2)18(22-4)10-14(12)13(11)9-17(15)21-3;1-7-4-2-6-3-5-7/h5-10H,1-4H3;6H,2-5H2,1H3 |
| InChIKey | DCVDYJKWUPRZIP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|