C9H15N3O5 — CID 174828481
4-(2-aminopropan-2-yloxy)-4-oxobutanoic acid;1,2,5-oxadiazole (PubChem CID 174828481) has the molecular formula C9H15N3O5 and a molecular weight of 245.23 g/mol. Its IUPAC name is 4-(2-aminopropan-2-yloxy)-4-oxobutanoic acid;1,2,5-oxadiazole.
| Compound Name | 4-(2-aminopropan-2-yloxy)-4-oxobutanoic acid;1,2,5-oxadiazole |
|---|---|
| PubChem CID | 174828481 |
| Molecular Formula | C9H15N3O5 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 4-(2-aminopropan-2-yloxy)-4-oxobutanoic acid;1,2,5-oxadiazole |
| SMILES | CC(C)(N)OC(=O)CCC(=O)O.c1cnon1 |
| InChI | InChI=1S/C7H13NO4.C2H2N2O/c1-7(2,8)12-6(11)4-3-5(9)10;1-2-4-5-3-1/h3-4,8H2,1-2H3,(H,9,10);1-2H |
| InChIKey | CJILOFFDMBHADH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|