About acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione
acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione (PubChem CID 174833706) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione.
Molecular Properties
| Compound Name | acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione |
| PubChem CID | 174833706 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione |
| SMILES | CC(N)=O.CC12C=CCCC1C(=O)OC2=O |
| InChI | InChI=1S/C9H10O3.C2H5NO/c1-9-5-3-2-4-6(9)7(10)12-8(9)11;1-2(3)4/h3,5-6H,2,4H2,1H3;1H3,(H2,3,4) |
| InChIKey | NCRDSADXIOHCRC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione?
The IUPAC name of acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione (CID 174833706) is acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione.
What is the SMILES notation for acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione?
The canonical SMILES for acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione is CC(N)=O.CC12C=CCCC1C(=O)OC2=O.
What is the InChIKey of acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione?
The InChIKey is NCRDSADXIOHCRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.C2H5NO/c1-9-5-3-2-4-6(9)7(10)12-8(9)11;1-2(3)4/h3,5-6H,2,4H2,1H3;1H3,(H2,3,4).
What are the key properties of acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione?
acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione has a molecular weight of 225.24 g/mol, XLogP of 0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione is sourced from PubChem (CID 174833706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).