C11H14O5 — CID 139628676
7a-(1,2-dihydroxypropyl)-4,5-dihydro-3aH-2-benzofuran-1,3-dione (PubChem CID 139628676) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 7a-(1,2-dihydroxypropyl)-4,5-dihydro-3aH-2-benzofuran-1,3-dione.
| Compound Name | 7a-(1,2-dihydroxypropyl)-4,5-dihydro-3aH-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 139628676 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 7a-(1,2-dihydroxypropyl)-4,5-dihydro-3aH-2-benzofuran-1,3-dione |
| SMILES | CC(O)C(O)C12C=CCCC1C(=O)OC2=O |
| InChI | InChI=1S/C11H14O5/c1-6(12)8(13)11-5-3-2-4-7(11)9(14)16-10(11)15/h3,5-8,12-13H,2,4H2,1H3 |
| InChIKey | INECHEAHEZUKAA-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|