amino sulfamate;dihydroxy(oxo)phosphanium

H6N2O6PS+ — CID 174840129

IUPACamino sulfamate;dihydroxy(oxo)phosphanium
SMILESNOS(N)(=O)=O.O=[P+](O)O
InChIInChI=1S/H4N2O3S.HO3P/c1-5-6(2,3)4;1-4(2)3/h1H2,(H2,2,3,4);(H-,1,2,3)/p+1
InChIKeyVSIBITPSXAIJBG-UHFFFAOYSA-O
MW193.10 g/mol
LogP-2.29
Rot. Bonds1

About amino sulfamate;dihydroxy(oxo)phosphanium

amino sulfamate;dihydroxy(oxo)phosphanium (PubChem CID 174840129) has the molecular formula H6N2O6PS+ and a molecular weight of 193.10 g/mol. Its IUPAC name is amino sulfamate;dihydroxy(oxo)phosphanium.

Molecular Properties

Compound Nameamino sulfamate;dihydroxy(oxo)phosphanium
PubChem CID174840129
Molecular FormulaH6N2O6PS+
Molecular Weight193.10 g/mol
Exact Mass192.97
IUPAC Nameamino sulfamate;dihydroxy(oxo)phosphanium
SMILESNOS(N)(=O)=O.O=[P+](O)O
InChIInChI=1S/H4N2O3S.HO3P/c1-5-6(2,3)4;1-4(2)3/h1H2,(H2,2,3,4);(H-,1,2,3)/p+1
InChIKeyVSIBITPSXAIJBG-UHFFFAOYSA-O
XLogP-2.29
TPSA152.94 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.10
LogP ≤ 5-2.29
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze amino sulfamate;dihydroxy(oxo)phosphanium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino sulfamate;dihydroxy(oxo)phosphanium?
The IUPAC name of amino sulfamate;dihydroxy(oxo)phosphanium (CID 174840129) is amino sulfamate;dihydroxy(oxo)phosphanium.
What is the SMILES notation for amino sulfamate;dihydroxy(oxo)phosphanium?
The canonical SMILES for amino sulfamate;dihydroxy(oxo)phosphanium is NOS(N)(=O)=O.O=[P+](O)O.
What is the InChIKey of amino sulfamate;dihydroxy(oxo)phosphanium?
The InChIKey is VSIBITPSXAIJBG-UHFFFAOYSA-O. The full InChI is InChI=1S/H4N2O3S.HO3P/c1-5-6(2,3)4;1-4(2)3/h1H2,(H2,2,3,4);(H-,1,2,3)/p+1.
What are the key properties of amino sulfamate;dihydroxy(oxo)phosphanium?
amino sulfamate;dihydroxy(oxo)phosphanium has a molecular weight of 193.10 g/mol, XLogP of -2.29, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino sulfamate;dihydroxy(oxo)phosphanium is sourced from PubChem (CID 174840129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).