C11H16N2 — CID 174840286
6-piperidin-1-ylcyclohexa-2,4-dien-1-imine (PubChem CID 174840286) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 6-piperidin-1-ylcyclohexa-2,4-dien-1-imine.
| Compound Name | 6-piperidin-1-ylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 174840286 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 6-piperidin-1-ylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=CC1N1CCCCC1 |
| InChI | InChI=1S/C11H16N2/c12-10-6-2-3-7-11(10)13-8-4-1-5-9-13/h2-3,6-7,11-12H,1,4-5,8-9H2/b12-10+ |
| InChIKey | MKGJTEMHZJQLBR-ZRDIBKRKSA-N |
| XLogP | 1.99 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|