About 3-bromodibenzothiophene;1H-indene
3-bromodibenzothiophene;1H-indene (PubChem CID 174843368) has the molecular formula C21H15BrS
and a molecular weight of 379.32 g/mol. Its IUPAC name is 3-bromodibenzothiophene;1H-indene.
Molecular Properties
| Compound Name | 3-bromodibenzothiophene;1H-indene |
| PubChem CID | 174843368 |
| Molecular Formula | C21H15BrS |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 3-bromodibenzothiophene;1H-indene |
| SMILES | Brc1ccc2c(c1)sc1ccccc12.C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C12H7BrS.C9H8/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8;1-2-5-9-7-3-6-8(9)4-1/h1-7H;1-6H,7H2 |
| InChIKey | GARYQCNUEHLKOB-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromodibenzothiophene;1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromodibenzothiophene;1H-indene?
The IUPAC name of 3-bromodibenzothiophene;1H-indene (CID 174843368) is 3-bromodibenzothiophene;1H-indene.
What is the SMILES notation for 3-bromodibenzothiophene;1H-indene?
The canonical SMILES for 3-bromodibenzothiophene;1H-indene is Brc1ccc2c(c1)sc1ccccc12.C1=Cc2ccccc2C1.
What is the InChIKey of 3-bromodibenzothiophene;1H-indene?
The InChIKey is GARYQCNUEHLKOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrS.C9H8/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8;1-2-5-9-7-3-6-8(9)4-1/h1-7H;1-6H,7H2.
What are the key properties of 3-bromodibenzothiophene;1H-indene?
3-bromodibenzothiophene;1H-indene has a molecular weight of 379.32 g/mol, XLogP of 7.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromodibenzothiophene;1H-indene is sourced from PubChem (CID 174843368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).