C7H16Cl3NSi — CID 174844337
N,N-diethyl-1-trichlorosilylpropan-1-amine (PubChem CID 174844337) has the molecular formula C7H16Cl3NSi and a molecular weight of 248.66 g/mol. Its IUPAC name is N,N-diethyl-1-trichlorosilylpropan-1-amine.
| Compound Name | N,N-diethyl-1-trichlorosilylpropan-1-amine |
|---|---|
| PubChem CID | 174844337 |
| Molecular Formula | C7H16Cl3NSi |
| Molecular Weight | 248.66 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | N,N-diethyl-1-trichlorosilylpropan-1-amine |
| SMILES | CCC(N(CC)CC)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C7H16Cl3NSi/c1-4-7(12(8,9)10)11(5-2)6-3/h7H,4-6H2,1-3H3 |
| InChIKey | NSEJMLDPPOEHSO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|