C21H48ClN3O3Si — CID 88532046
1-[1-chloropropyl-bis[1-(diethylamino)ethoxy]silyl]oxy-N,N-diethylethanamine (PubChem CID 88532046) has the molecular formula C21H48ClN3O3Si and a molecular weight of 454.17 g/mol. Its IUPAC name is 1-[1-chloropropyl-bis[1-(diethylamino)ethoxy]silyl]oxy-N,N-diethylethanamine.
| Compound Name | 1-[1-chloropropyl-bis[1-(diethylamino)ethoxy]silyl]oxy-N,N-diethylethanamine |
|---|---|
| PubChem CID | 88532046 |
| Molecular Formula | C21H48ClN3O3Si |
| Molecular Weight | 454.17 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | 1-[1-chloropropyl-bis[1-(diethylamino)ethoxy]silyl]oxy-N,N-diethylethanamine |
| SMILES | CCC(Cl)[Si](OC(C)N(CC)CC)(OC(C)N(CC)CC)OC(C)N(CC)CC |
| InChI | InChI=1S/C21H48ClN3O3Si/c1-11-21(22)29(26-18(8)23(12-2)13-3,27-19(9)24(14-4)15-5)28-20(10)25(16-6)17-7/h18-21H,11-17H2,1-10H3 |
| InChIKey | PJEMSLRHZJXQJY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.17 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|