C8H21NO2Si — CID 173381217
N,N-diethyl-1-[methoxy(methyl)silyl]oxyethanamine (PubChem CID 173381217) has the molecular formula C8H21NO2Si and a molecular weight of 191.35 g/mol. Its IUPAC name is N,N-diethyl-1-[methoxy(methyl)silyl]oxyethanamine.
| Compound Name | N,N-diethyl-1-[methoxy(methyl)silyl]oxyethanamine |
|---|---|
| PubChem CID | 173381217 |
| Molecular Formula | C8H21NO2Si |
| Molecular Weight | 191.35 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N,N-diethyl-1-[methoxy(methyl)silyl]oxyethanamine |
| SMILES | CCN(CC)C(C)O[SiH](C)OC |
| InChI | InChI=1S/C8H21NO2Si/c1-6-9(7-2)8(3)11-12(5)10-4/h8,12H,6-7H2,1-5H3 |
| InChIKey | WDMXJKNCJZRMPO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|