C30H30Cl2N3O5+ — CID 174845396
benzyl-dimethyl-(2-phenoxyethyl)azanium;5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide (PubChem CID 174845396) has the molecular formula C30H30Cl2N3O5+ and a molecular weight of 583.49 g/mol. Its IUPAC name is benzyl-dimethyl-(2-phenoxyethyl)azanium;5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide.
| Compound Name | benzyl-dimethyl-(2-phenoxyethyl)azanium;5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 174845396 |
| Molecular Formula | C30H30Cl2N3O5+ |
| Molecular Weight | 583.49 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | benzyl-dimethyl-(2-phenoxyethyl)azanium;5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| SMILES | C[N+](C)(CCOc1ccccc1)Cc1ccccc1.O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H22NO.C13H8Cl2N2O4/c1-18(2,15-16-9-5-3-6-10-16)13-14-19-17-11-7-4-8-12-17;14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h3-12H,13-15H2,1-2H3;1-6,18H,(H,16,19)/q+1; |
| InChIKey | SBQKFOOUMDMHNU-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.49 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|