C16H24N2O4 — CID 174848384
(2,5-dioxopyrrol-1-yl) 3-(2,2,6,6-tetramethylpiperidin-1-yl)propanoate (PubChem CID 174848384) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) 3-(2,2,6,6-tetramethylpiperidin-1-yl)propanoate.
| Compound Name | (2,5-dioxopyrrol-1-yl) 3-(2,2,6,6-tetramethylpiperidin-1-yl)propanoate |
|---|---|
| PubChem CID | 174848384 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) 3-(2,2,6,6-tetramethylpiperidin-1-yl)propanoate |
| SMILES | CC1(C)CCCC(C)(C)N1CCC(=O)ON1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H24N2O4/c1-15(2)9-5-10-16(3,4)17(15)11-8-14(21)22-18-12(19)6-7-13(18)20/h6-7H,5,8-11H2,1-4H3 |
| InChIKey | NCENBLYIVNSUKJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|