C21H19Cl2N5O4 — CID 174852404
4-[2-[[2-amino-6-(2,3-dichlorophenyl)pyrimidin-4-yl]amino]ethylamino]-6-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174852404) has the molecular formula C21H19Cl2N5O4 and a molecular weight of 476.32 g/mol. Its IUPAC name is 4-[2-[[2-amino-6-(2,3-dichlorophenyl)pyrimidin-4-yl]amino]ethylamino]-6-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 4-[2-[[2-amino-6-(2,3-dichlorophenyl)pyrimidin-4-yl]amino]ethylamino]-6-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174852404 |
| Molecular Formula | C21H19Cl2N5O4 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 4-[2-[[2-amino-6-(2,3-dichlorophenyl)pyrimidin-4-yl]amino]ethylamino]-6-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1cc(NCCNc2cc(-c3cccc(Cl)c3Cl)nc(N)n2)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C21H19Cl2N5O4/c1-10-7-15(13(20(31)32)8-12(10)19(29)30)25-5-6-26-17-9-16(27-21(24)28-17)11-3-2-4-14(22)18(11)23/h2-4,7-9,25H,5-6H2,1H3,(H,29,30)(H,31,32)(H3,24,26,27,28) |
| InChIKey | LAHKXCISOXQJGI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 150.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|