C22H20Cl4N4O — CID 158825706
6-[[2-amino-6-(2,3-dichlorophenyl)pyrimidin-4-yl]amino]-1-(3,4-dichlorophenyl)hexan-1-one (PubChem CID 158825706) has the molecular formula C22H20Cl4N4O and a molecular weight of 498.24 g/mol. Its IUPAC name is 6-[[2-amino-6-(2,3-dichlorophenyl)pyrimidin-4-yl]amino]-1-(3,4-dichlorophenyl)hexan-1-one.
| Compound Name | 6-[[2-amino-6-(2,3-dichlorophenyl)pyrimidin-4-yl]amino]-1-(3,4-dichlorophenyl)hexan-1-one |
|---|---|
| PubChem CID | 158825706 |
| Molecular Formula | C22H20Cl4N4O |
| Molecular Weight | 498.24 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | 6-[[2-amino-6-(2,3-dichlorophenyl)pyrimidin-4-yl]amino]-1-(3,4-dichlorophenyl)hexan-1-one |
| SMILES | Nc1nc(NCCCCCC(=O)c2ccc(Cl)c(Cl)c2)cc(-c2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C22H20Cl4N4O/c23-15-9-8-13(11-17(15)25)19(31)7-2-1-3-10-28-20-12-18(29-22(27)30-20)14-5-4-6-16(24)21(14)26/h4-6,8-9,11-12H,1-3,7,10H2,(H3,27,28,29,30) |
| InChIKey | JUFGABQOVICCNG-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.24 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|