C16H36O5 — CID 174858885
4-ethylnonane-1,2,3-triol;pentane-1,2-diol (PubChem CID 174858885) has the molecular formula C16H36O5 and a molecular weight of 308.46 g/mol. Its IUPAC name is 4-ethylnonane-1,2,3-triol;pentane-1,2-diol.
| Compound Name | 4-ethylnonane-1,2,3-triol;pentane-1,2-diol |
|---|---|
| PubChem CID | 174858885 |
| Molecular Formula | C16H36O5 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | 4-ethylnonane-1,2,3-triol;pentane-1,2-diol |
| SMILES | CCCC(O)CO.CCCCCC(CC)C(O)C(O)CO |
| InChI | InChI=1S/C11H24O3.C5H12O2/c1-3-5-6-7-9(4-2)11(14)10(13)8-12;1-2-3-5(7)4-6/h9-14H,3-8H2,1-2H3;5-7H,2-4H2,1H3 |
| InChIKey | AJXGKOCRQHGCEQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|