C17H13F17OSi — CID 174870139
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane;methyl-oxo-phenylsilane (PubChem CID 174870139) has the molecular formula C17H13F17OSi and a molecular weight of 584.34 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane;methyl-oxo-phenylsilane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane;methyl-oxo-phenylsilane |
|---|---|
| PubChem CID | 174870139 |
| Molecular Formula | C17H13F17OSi |
| Molecular Weight | 584.34 g/mol |
| Exact Mass | 584.05 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane;methyl-oxo-phenylsilane |
| SMILES | CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.C[Si](=O)c1ccccc1 |
| InChI | InChI=1S/C10H5F17.C7H8OSi/c1-2-3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27;1-9(8)7-5-3-2-4-6-7/h2H2,1H3;2-6H,1H3 |
| InChIKey | BUKDSJWAADQTTF-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.34 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|