C12H20Cl2O2 — CID 174870243
4-butylocta-3,5-diene-2,7-dione;dihydrochloride (PubChem CID 174870243) has the molecular formula C12H20Cl2O2 and a molecular weight of 267.20 g/mol. Its IUPAC name is 4-butylocta-3,5-diene-2,7-dione;dihydrochloride.
| Compound Name | 4-butylocta-3,5-diene-2,7-dione;dihydrochloride |
|---|---|
| PubChem CID | 174870243 |
| Molecular Formula | C12H20Cl2O2 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4-butylocta-3,5-diene-2,7-dione;dihydrochloride |
| SMILES | CCCCC(C=CC(C)=O)=CC(C)=O.Cl.Cl |
| InChI | InChI=1S/C12H18O2.2ClH/c1-4-5-6-12(9-11(3)14)8-7-10(2)13;;/h7-9H,4-6H2,1-3H3;2*1H |
| InChIKey | UZWGAWVIGCLDEO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|