C8H16N2O5 — CID 174870463
2-(2,2,2-trihydroxyethyl)hexanediamide (PubChem CID 174870463) has the molecular formula C8H16N2O5 and a molecular weight of 220.22 g/mol. Its IUPAC name is 2-(2,2,2-trihydroxyethyl)hexanediamide.
| Compound Name | 2-(2,2,2-trihydroxyethyl)hexanediamide |
|---|---|
| PubChem CID | 174870463 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-(2,2,2-trihydroxyethyl)hexanediamide |
| SMILES | NC(=O)CCCC(CC(O)(O)O)C(N)=O |
| InChI | InChI=1S/C8H16N2O5/c9-6(11)3-1-2-5(7(10)12)4-8(13,14)15/h5,13-15H,1-4H2,(H2,9,11)(H2,10,12) |
| InChIKey | KFVOLTJMGCVPEF-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|