C24H49NO — CID 88970425
6,6,9,9-tetramethyl-2-(2,2,5,5-tetramethylhexyl)decanamide (PubChem CID 88970425) has the molecular formula C24H49NO and a molecular weight of 367.66 g/mol. Its IUPAC name is 6,6,9,9-tetramethyl-2-(2,2,5,5-tetramethylhexyl)decanamide.
| Compound Name | 6,6,9,9-tetramethyl-2-(2,2,5,5-tetramethylhexyl)decanamide |
|---|---|
| PubChem CID | 88970425 |
| Molecular Formula | C24H49NO |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 367.38 |
| IUPAC Name | 6,6,9,9-tetramethyl-2-(2,2,5,5-tetramethylhexyl)decanamide |
| SMILES | CC(C)(C)CCC(C)(C)CCCC(CC(C)(C)CCC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C24H49NO/c1-21(2,3)14-16-23(7,8)13-11-12-19(20(25)26)18-24(9,10)17-15-22(4,5)6/h19H,11-18H2,1-10H3,(H2,25,26) |
| InChIKey | QDJCNZKPLVPSOA-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |