About benzylphosphane;phenoxybenzene;hydrobromide
benzylphosphane;phenoxybenzene;hydrobromide (PubChem CID 174878285) has the molecular formula C19H20BrOP
and a molecular weight of 375.25 g/mol. Its IUPAC name is benzylphosphane;phenoxybenzene;hydrobromide.
Molecular Properties
| Compound Name | benzylphosphane;phenoxybenzene;hydrobromide |
| PubChem CID | 174878285 |
| Molecular Formula | C19H20BrOP |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | benzylphosphane;phenoxybenzene;hydrobromide |
| SMILES | Br.PCc1ccccc1.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C7H9P.BrH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7;/h1-10H;1-5H,6,8H2;1H |
| InChIKey | YUJQGELMRIXKCO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzylphosphane;phenoxybenzene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylphosphane;phenoxybenzene;hydrobromide?
The IUPAC name of benzylphosphane;phenoxybenzene;hydrobromide (CID 174878285) is benzylphosphane;phenoxybenzene;hydrobromide.
What is the SMILES notation for benzylphosphane;phenoxybenzene;hydrobromide?
The canonical SMILES for benzylphosphane;phenoxybenzene;hydrobromide is Br.PCc1ccccc1.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of benzylphosphane;phenoxybenzene;hydrobromide?
The InChIKey is YUJQGELMRIXKCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C7H9P.BrH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7;/h1-10H;1-5H,6,8H2;1H.
What are the key properties of benzylphosphane;phenoxybenzene;hydrobromide?
benzylphosphane;phenoxybenzene;hydrobromide has a molecular weight of 375.25 g/mol, XLogP of 6.12, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzylphosphane;phenoxybenzene;hydrobromide is sourced from PubChem (CID 174878285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).