C15H32N2O4S — CID 174880367
butane-1-sulfonic acid;5-(dipropylamino)pent-2-enamide (PubChem CID 174880367) has the molecular formula C15H32N2O4S and a molecular weight of 336.50 g/mol. Its IUPAC name is butane-1-sulfonic acid;5-(dipropylamino)pent-2-enamide.
| Compound Name | butane-1-sulfonic acid;5-(dipropylamino)pent-2-enamide |
|---|---|
| PubChem CID | 174880367 |
| Molecular Formula | C15H32N2O4S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | butane-1-sulfonic acid;5-(dipropylamino)pent-2-enamide |
| SMILES | CCCCS(=O)(=O)O.CCCN(CCC)CCC=CC(N)=O |
| InChI | InChI=1S/C11H22N2O.C4H10O3S/c1-3-8-13(9-4-2)10-6-5-7-11(12)14;1-2-3-4-8(5,6)7/h5,7H,3-4,6,8-10H2,1-2H3,(H2,12,14);2-4H2,1H3,(H,5,6,7) |
| InChIKey | XGSHSBOGKBGGMC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|