About hydron;methyl 2-tellanylpropanoate
hydron;methyl 2-tellanylpropanoate (PubChem CID 174889202) has the molecular formula C4H9O2Te+
and a molecular weight of 216.71 g/mol. Its IUPAC name is hydron;methyl 2-tellanylpropanoate.
Molecular Properties
| Compound Name | hydron;methyl 2-tellanylpropanoate |
| PubChem CID | 174889202 |
| Molecular Formula | C4H9O2Te+ |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 218.97 |
| IUPAC Name | hydron;methyl 2-tellanylpropanoate |
| SMILES | COC(=O)C(C)[TeH].[H+] |
| InChI | InChI=1S/C4H8O2Te/c1-3(7)4(5)6-2/h3,7H,1-2H3/p+1 |
| InChIKey | OCPNBBJSUWQADT-UHFFFAOYSA-O |
| XLogP | -0.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hydron;methyl 2-tellanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;methyl 2-tellanylpropanoate?
The IUPAC name of hydron;methyl 2-tellanylpropanoate (CID 174889202) is hydron;methyl 2-tellanylpropanoate.
What is the SMILES notation for hydron;methyl 2-tellanylpropanoate?
The canonical SMILES for hydron;methyl 2-tellanylpropanoate is COC(=O)C(C)[TeH].[H+].
What is the InChIKey of hydron;methyl 2-tellanylpropanoate?
The InChIKey is OCPNBBJSUWQADT-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H8O2Te/c1-3(7)4(5)6-2/h3,7H,1-2H3/p+1.
What are the key properties of hydron;methyl 2-tellanylpropanoate?
hydron;methyl 2-tellanylpropanoate has a molecular weight of 216.71 g/mol, XLogP of -0.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;methyl 2-tellanylpropanoate is sourced from PubChem (CID 174889202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).