C34H46O6 — CID 174892458
2,2-di(butan-2-yloxy)-1-phenylethanone;1,2-diethoxybenzene;1-phenylethanone (PubChem CID 174892458) has the molecular formula C34H46O6 and a molecular weight of 550.74 g/mol. Its IUPAC name is 2,2-di(butan-2-yloxy)-1-phenylethanone;1,2-diethoxybenzene;1-phenylethanone.
| Compound Name | 2,2-di(butan-2-yloxy)-1-phenylethanone;1,2-diethoxybenzene;1-phenylethanone |
|---|---|
| PubChem CID | 174892458 |
| Molecular Formula | C34H46O6 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | 2,2-di(butan-2-yloxy)-1-phenylethanone;1,2-diethoxybenzene;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.CCC(C)OC(OC(C)CC)C(=O)c1ccccc1.CCOc1ccccc1OCC |
| InChI | InChI=1S/C16H24O3.C10H14O2.C8H8O/c1-5-12(3)18-16(19-13(4)6-2)15(17)14-10-8-7-9-11-14;1-3-11-9-7-5-6-8-10(9)12-4-2;1-7(9)8-5-3-2-4-6-8/h7-13,16H,5-6H2,1-4H3;5-8H,3-4H2,1-2H3;2-6H,1H3 |
| InChIKey | VYDKLEYEKWOCTC-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|