C30H36O5 — CID 70504517
2,2-di(butan-2-yloxy)-1-phenylethanone;(4-methoxyphenyl)-phenylmethanone (PubChem CID 70504517) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is 2,2-di(butan-2-yloxy)-1-phenylethanone;(4-methoxyphenyl)-phenylmethanone.
| Compound Name | 2,2-di(butan-2-yloxy)-1-phenylethanone;(4-methoxyphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 70504517 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 2,2-di(butan-2-yloxy)-1-phenylethanone;(4-methoxyphenyl)-phenylmethanone |
| SMILES | CCC(C)OC(OC(C)CC)C(=O)c1ccccc1.COc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H24O3.C14H12O2/c1-5-12(3)18-16(19-13(4)6-2)15(17)14-10-8-7-9-11-14;1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h7-13,16H,5-6H2,1-4H3;2-10H,1H3 |
| InChIKey | PQPRXPZYAGTHQH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|