C12H22O6 — CID 174897598
benzene-1,4-diol;butane-2,3-diol;ethane-1,2-diol (PubChem CID 174897598) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is benzene-1,4-diol;butane-2,3-diol;ethane-1,2-diol.
| Compound Name | benzene-1,4-diol;butane-2,3-diol;ethane-1,2-diol |
|---|---|
| PubChem CID | 174897598 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | benzene-1,4-diol;butane-2,3-diol;ethane-1,2-diol |
| SMILES | CC(O)C(C)O.OCCO.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.C4H10O2.C2H6O2/c7-5-1-2-6(8)4-3-5;1-3(5)4(2)6;3-1-2-4/h1-4,7-8H;3-6H,1-2H3;3-4H,1-2H2 |
| InChIKey | MCMZYTGAVRAOIB-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|