C18H34O5 — CID 174899382
cyclohexene;hexane-1,1-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174899382) has the molecular formula C18H34O5 and a molecular weight of 330.46 g/mol. Its IUPAC name is cyclohexene;hexane-1,1-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | cyclohexene;hexane-1,1-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 174899382 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | cyclohexene;hexane-1,1-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.C1=CCCCC1.CCCCCC(O)O |
| InChI | InChI=1S/C6H10O3.C6H14O2.C6H10/c1(5-3-8-5)7-2-6-4-9-6;1-2-3-4-5-6(7)8;1-2-4-6-5-3-1/h5-6H,1-4H2;6-8H,2-5H2,1H3;1-2H,3-6H2 |
| InChIKey | ZABJOIYQWAKMQS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|