C23H23FO — CID 174900500
2H-pyran;1,2,3,4-tetrahydrochrysene;hydrofluoride (PubChem CID 174900500) has the molecular formula C23H23FO and a molecular weight of 334.43 g/mol. Its IUPAC name is 2H-pyran;1,2,3,4-tetrahydrochrysene;hydrofluoride.
| Compound Name | 2H-pyran;1,2,3,4-tetrahydrochrysene;hydrofluoride |
|---|---|
| PubChem CID | 174900500 |
| Molecular Formula | C23H23FO |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2H-pyran;1,2,3,4-tetrahydrochrysene;hydrofluoride |
| SMILES | C1=CCOC=C1.F.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C5H6O.FH/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-4-6-5-3-1;/h1,3,5,7,9-12H,2,4,6,8H2;1-4H,5H2;1H |
| InChIKey | IGVLMUCBQMUWEY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|