C24H23N3O — CID 174555957
2-(azidomethyl)-1,2,3,4-tetrahydrochrysene;2H-pyran (PubChem CID 174555957) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-(azidomethyl)-1,2,3,4-tetrahydrochrysene;2H-pyran.
| Compound Name | 2-(azidomethyl)-1,2,3,4-tetrahydrochrysene;2H-pyran |
|---|---|
| PubChem CID | 174555957 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-(azidomethyl)-1,2,3,4-tetrahydrochrysene;2H-pyran |
| SMILES | C1=CCOC=C1.[N-]=[N+]=NCC1CCc2c(ccc3c2ccc2ccccc23)C1 |
| InChI | InChI=1S/C19H17N3.C5H6O/c20-22-21-12-13-5-8-17-15(11-13)7-10-18-16-4-2-1-3-14(16)6-9-19(17)18;1-2-4-6-5-3-1/h1-4,6-7,9-10,13H,5,8,11-12H2;1-4H,5H2 |
| InChIKey | GONWEQBUVNRFBR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|