C12H17N5O3 — CID 174902670
3H-benzimidazol-5-amine;2,5-diamino-5-oxopentanoic acid (PubChem CID 174902670) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3H-benzimidazol-5-amine;2,5-diamino-5-oxopentanoic acid.
| Compound Name | 3H-benzimidazol-5-amine;2,5-diamino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174902670 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3H-benzimidazol-5-amine;2,5-diamino-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)O.Nc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C7H7N3.C5H10N2O3/c8-5-1-2-6-7(3-5)10-4-9-6;6-3(5(9)10)1-2-4(7)8/h1-4H,8H2,(H,9,10);3H,1-2,6H2,(H2,7,8)(H,9,10) |
| InChIKey | SZGPGOVIIQNAFK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 161.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|