About sodium;cyanoboranuide;propan-2-ol
sodium;cyanoboranuide;propan-2-ol (PubChem CID 174903937) has the molecular formula C4H11BNNaO
and a molecular weight of 122.94 g/mol. Its IUPAC name is sodium;cyanoboranuide;propan-2-ol.
Molecular Properties
| Compound Name | sodium;cyanoboranuide;propan-2-ol |
| PubChem CID | 174903937 |
| Molecular Formula | C4H11BNNaO |
| Molecular Weight | 122.94 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | sodium;cyanoboranuide;propan-2-ol |
| SMILES | CC(C)O.[BH3-]C#N.[Na+] |
| InChI | InChI=1S/C3H8O.CH3BN.Na/c1-3(2)4;2-1-3;/h3-4H,1-2H3;2H3;/q;-1;+1 |
| InChIKey | KORRISOEPWZRRO-UHFFFAOYSA-N |
| XLogP | -3.78 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.94 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;cyanoboranuide;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;cyanoboranuide;propan-2-ol?
The IUPAC name of sodium;cyanoboranuide;propan-2-ol (CID 174903937) is sodium;cyanoboranuide;propan-2-ol.
What is the SMILES notation for sodium;cyanoboranuide;propan-2-ol?
The canonical SMILES for sodium;cyanoboranuide;propan-2-ol is CC(C)O.[BH3-]C#N.[Na+].
What is the InChIKey of sodium;cyanoboranuide;propan-2-ol?
The InChIKey is KORRISOEPWZRRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.CH3BN.Na/c1-3(2)4;2-1-3;/h3-4H,1-2H3;2H3;/q;-1;+1.
What are the key properties of sodium;cyanoboranuide;propan-2-ol?
sodium;cyanoboranuide;propan-2-ol has a molecular weight of 122.94 g/mol, XLogP of -3.78, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;cyanoboranuide;propan-2-ol is sourced from PubChem (CID 174903937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).