C8H9N3OS — CID 174905845
1H-pyrrole-2-carboxamide;1,3-thiazole (PubChem CID 174905845) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is 1H-pyrrole-2-carboxamide;1,3-thiazole.
| Compound Name | 1H-pyrrole-2-carboxamide;1,3-thiazole |
|---|---|
| PubChem CID | 174905845 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 1H-pyrrole-2-carboxamide;1,3-thiazole |
| SMILES | NC(=O)c1ccc[nH]1.c1cscn1 |
| InChI | InChI=1S/C5H6N2O.C3H3NS/c6-5(8)4-2-1-3-7-4;1-2-5-3-4-1/h1-3,7H,(H2,6,8);1-3H |
| InChIKey | BEPVALIDPFXHGX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |